CAS 14273-92-8
:methyl 5-hydroxypentanoate
Description:
Methyl 5-hydroxypentanoate, with the CAS number 14273-92-8, is an ester derived from pentanoic acid and methanol, featuring a hydroxyl group at the fifth carbon position. This compound typically appears as a colorless to pale yellow liquid with a characteristic fruity odor, which is common among esters. It is soluble in organic solvents and exhibits moderate solubility in water due to the presence of the hydroxyl group, which can engage in hydrogen bonding. Methyl 5-hydroxypentanoate is primarily used in the synthesis of various chemical intermediates and may find applications in flavoring and fragrance industries. Its chemical structure allows for potential reactivity in esterification and transesterification reactions. Additionally, it may serve as a building block in the production of more complex organic compounds. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H12O3
InChI:InChI=1/C6H12O3/c1-9-6(8)4-2-3-5-7/h7H,2-5H2,1H3
SMILES:COC(=O)CCCCO
Synonyms:- Pentanoic acid, 5-hydroxy-, methyl ester
- Methyl 5-hydroxypentanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Hydroxypentanoic acid methyl ester
CAS:5-Hydroxypentanoic acid methyl esterFormula:C6H12O3Purity:95%Color and Shape:LiquidMolecular weight:132.15767Pentanoic acid,5-hydroxy-, methyl ester
CAS:Formula:C6H12O3Purity:97%Color and Shape:LiquidMolecular weight:132.1577Methyl 5-hydroxypentanoate
CAS:Methyl 5-hydroxypentanoateFormula:C6H12O3Purity:95%Molecular weight:132.16Methyl 5-hydroxypentanoate
CAS:Methyl 5-hydroxypentanoate is a chiral, liquid phase solvent. It is used in the synthesis of levulinic acid and butyrolactone. The reaction system consists of methyl 5-hydroxypentanoate, methanol, and sulfuric acid. The hydroxyl group on the methyl 5-hydroxypentanoate reacts with the carbonyl group on methanol to form water, carbon dioxide, and methyl 5-oxopentanoate. Furfural and methoxy are formed as reaction products. The kinetic for this reaction was found to be first order with respect to both reactants. This means that the rate of reaction is proportional to the concentration of reactants present. Methyl 5-hydroxypentanoate is typically used in conjunction with other solvents such as diethyl ether or acetic acid because it can be difficult to work with alone due to its low boiling point.Purity:Min. 95%




