CymitQuimica logo

CAS 1428243-26-8

:

(3R,4S)-3-(2-Bromoacetyl)-4-ethyl-1-pyrrolidinecarboxylic acid phenylmethyl ester

Description:
The chemical substance known as (3R,4S)-3-(2-Bromoacetyl)-4-ethyl-1-pyrrolidinecarboxylic acid phenylmethyl ester, with the CAS number 1428243-26-8, is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and includes a bromoacetyl group that introduces reactivity due to the presence of the bromine atom. The ethyl group contributes to the hydrophobic character of the molecule, while the phenylmethyl ester moiety enhances its lipophilicity and may influence its biological activity. The stereochemistry indicated by the (3R,4S) configuration suggests that the compound has specific spatial arrangements that can significantly affect its interaction with biological targets, making it potentially relevant in medicinal chemistry. Overall, this compound's unique structure may confer specific properties, such as solubility, reactivity, and biological activity, which are essential for its application in research or pharmaceutical development.
Formula:C16H20BrNO3
InChI:InChI=1S/C16H20BrNO3/c1-2-13-9-18(10-14(13)15(19)8-17)16(20)21-11-12-6-4-3-5-7-12/h3-7,13-14H,2,8-11H2,1H3/t13-,14+/m1/s1
InChI key:QEFUCTKHMXMWRF-KGLIPLIRSA-N
SMILES:CC[C@@H]1CN(C[C@@H]1C(=O)CBr)C(=O)OCC2=CC=CC=C2
Found 7 products.