CymitQuimica logo

CAS 142847-18-5

:

Tyrosine, N-[(1,1-dimethylethoxy)carbonyl]-

Description:
Tyrosine, N-[(1,1-dimethylethoxy)carbonyl]- is a derivative of the amino acid tyrosine, which is known for its role in protein synthesis and as a precursor for neurotransmitters. This specific compound features a protective group, the 1,1-dimethylethoxycarbonyl group, which is commonly used in organic synthesis to enhance the stability and reactivity of the amino group. The presence of this protective group allows for selective reactions without interfering with the amino acid's functional properties. The compound is typically a white to off-white solid and is soluble in organic solvents, making it useful in various chemical reactions, particularly in peptide synthesis. Its molecular structure includes a phenolic hydroxyl group, contributing to its potential biological activity. As with many chemical substances, safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled. Overall, this compound is significant in the field of medicinal chemistry and biochemistry for its applications in drug development and synthesis.
Formula:C14H19NO5
InChI:InChI=1S/C14H19NO5/c1-14(2,3)20-13(19)15-11(12(17)18)8-9-4-6-10(16)7-5-9/h4-7,11,16H,8H2,1-3H3,(H,15,19)(H,17,18)
InChI key:CNBUSIJNWNXLQQ-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)O)C(=O)O
Synonyms:
  • Boc-DL-tyrosine
  • Boc-DL-Tyr-OH
Found 2 products.