CymitQuimica logo

CAS 142896-15-9

:

4-Pyridinecarboxylic acid, 2,6-dimethyl-, methyl ester

Description:
4-Pyridinecarboxylic acid, 2,6-dimethyl-, methyl ester, also known as methyl 2,6-dimethyl-4-pyridinecarboxylate, is an organic compound characterized by its pyridine ring structure substituted with carboxylic acid and methyl groups. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents such as ethanol and acetone but has limited solubility in water due to its hydrophobic methyl groups. The presence of the pyridine ring imparts basic properties, allowing it to participate in various chemical reactions, including esterification and nucleophilic substitutions. This compound is of interest in organic synthesis and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, or other fine chemicals. Its chemical stability and reactivity can be influenced by the functional groups present, making it a versatile building block in synthetic chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C9H11NO2
InChI:InChI=1S/C9H11NO2/c1-6-4-8(9(11)12-3)5-7(2)10-6/h4-5H,1-3H3
InChI key:MLDMYLXCMZTSHX-UHFFFAOYSA-N
SMILES:CC1=CC(=CC(=N1)C)C(=O)OC
Synonyms:
  • Methyl 2,6-dimethylpyridine-4-carboxylate
Found 4 products.