CymitQuimica logo

CAS 1429419-24-8

:

4-Bromo-1-(2-fluoroethyl)-1H-pyrazole-5-carboxylic acid

Description:
4-Bromo-1-(2-fluoroethyl)-1H-pyrazole-5-carboxylic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of a bromine atom at the 4-position and a 2-fluoroethyl group at the 1-position contributes to its unique reactivity and potential applications in medicinal chemistry. The carboxylic acid functional group at the 5-position enhances its acidity and solubility in polar solvents, making it suitable for various chemical reactions and synthesis processes. This compound may exhibit biological activity, potentially serving as a lead compound in drug development, particularly in areas targeting specific receptors or enzymes. Its molecular structure allows for various modifications, which can influence its pharmacological properties. As with many halogenated compounds, it may also exhibit interesting electronic properties due to the presence of the bromine and fluorine substituents. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.
Formula:C6H6BrFN2O2
InChI:InChI=1S/C6H6BrFN2O2/c7-4-3-9-10(2-1-8)5(4)6(11)12/h3H,1-2H2,(H,11,12)
InChI key:InChIKey=VQNJMDZNYLUGBI-UHFFFAOYSA-N
SMILES:C(CF)N1C(C(O)=O)=C(Br)C=N1
Synonyms:
  • 4-Bromo-1-(2-fluoroethyl)-1H-pyrazole-5-carboxylic acid
  • 1H-Pyrazole-5-carboxylic acid, 4-bromo-1-(2-fluoroethyl)-
Found 1 products.