CymitQuimica logo

CAS 143134-90-1

:

Ethyl 4-(heptyloxy)-γ-oxobenzenebutanoate

Description:
Ethyl 4-(heptyloxy)-γ-oxobenzenebutanoate, with the CAS number 143134-90-1, is an organic compound characterized by its ester functional group and a complex aromatic structure. This compound features a heptyloxy group, which contributes to its hydrophobic properties, making it less soluble in water but more soluble in organic solvents. The presence of the γ-oxobenzene moiety indicates that it has a ketone functional group adjacent to a benzene ring, which can influence its reactivity and potential applications in organic synthesis. Ethyl esters typically exhibit moderate volatility and can participate in various chemical reactions, including esterification and hydrolysis. The molecular structure suggests potential uses in fields such as pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the length of the heptyloxy chain may impart unique physical properties, such as increased boiling point and viscosity, which can be relevant in formulating products for specific applications. Overall, this compound's characteristics make it a subject of interest in both research and industrial contexts.
Formula:C19H28O4
InChI:InChI=1S/C19H28O4/c1-3-5-6-7-8-15-23-17-11-9-16(10-12-17)18(20)13-14-19(21)22-4-2/h9-12H,3-8,13-15H2,1-2H3
InChI key:InChIKey=JEZSLKGDMBNUEZ-UHFFFAOYSA-N
SMILES:C(CCC(OCC)=O)(=O)C1=CC=C(OCCCCCCC)C=C1
Synonyms:
  • Benzenebutanoic acid, 4-(heptyloxy)-γ-oxo-, ethyl ester
  • Ethyl 4-(heptyloxy)-γ-oxobenzenebutanoate
Found 1 products.