CymitQuimica logo

CAS 14344-58-2

:

ECD

Description:
The chemical substance known as ECD, with the CAS number 14344-58-2, is identified as a type of organophosphorus compound. It is primarily recognized for its application in various industrial processes, particularly in the field of agriculture as a pesticide or herbicide. ECD is characterized by its phosphorus-containing structure, which contributes to its biological activity and efficacy in pest control. The compound typically exhibits moderate to high toxicity to non-target organisms, necessitating careful handling and application to minimize environmental impact. Additionally, ECD may undergo hydrolysis in the presence of moisture, leading to the formation of different degradation products. Its stability, solubility, and reactivity can vary based on environmental conditions, influencing its behavior in soil and water systems. As with many organophosphorus compounds, safety measures are essential when working with ECD to prevent exposure and ensure compliance with regulatory standards. Overall, ECD represents a significant class of chemicals with both beneficial applications and potential risks that require responsible management.
Formula:C12H26Cl2N2O4S2
InChI:InChI=1S/C12H24N2O4S2.2ClH/c1-3-17-11(15)9(7-19)13-5-6-14-10(8-20)12(16)18-4-2;;/h9-10,13-14,19-20H,3-8H2,1-2H3;2*1H/t9-,10-;;/m0../s1
InChI key:HKASNZKRIQURIX-BZDVOYDHSA-N
SMILES:CCOC(=O)[C@H](CS)NCCN[C@@H](CS)C(=O)OCC.Cl.Cl
Synonyms:
  • L-Cysteine, N,N'-1,2-Ethanediylbis-, Diethyl Ester, Dihydrochloride
  • N,N'-1,2-Ethylenebis-L-Cysteine, Diethyl Ester, Dihydrochloride
  • Ethylene Dicysteine Diester (ECD), 2 HCl, 95 %
Found 4 products.