CymitQuimica logo

CAS 143443-23-6

:

1,2-Cyclohexanediamine, N,N'-bis(phenylmethyl)-, (1R,2R)-

Description:
1,2-Cyclohexanediamine, N,N'-bis(phenylmethyl)-, (1R,2R)- is a chiral organic compound characterized by its cyclohexane backbone with two amine functional groups and two phenylmethyl substituents. The (1R,2R) designation indicates the specific stereochemistry of the molecule, which can influence its reactivity and interactions in various chemical environments. This compound is typically used in organic synthesis and may serve as a ligand in coordination chemistry due to the presence of the amine groups, which can coordinate with metal ions. Its structure allows for potential applications in pharmaceuticals, agrochemicals, and materials science. The presence of the phenylmethyl groups enhances its hydrophobic character, which can affect solubility and biological activity. Additionally, the compound's chirality may lead to different biological effects depending on the enantiomer used, making it important in the development of enantiomerically pure substances for specific applications. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C20H26N2
InChI:InChI=1S/C20H26N2/c1-3-9-17(10-4-1)15-21-19-13-7-8-14-20(19)22-16-18-11-5-2-6-12-18/h1-6,9-12,19-22H,7-8,13-16H2/t19-,20-/m1/s1
InChI key:SJBYIGXWWGSEES-WOJBJXKFSA-N
SMILES:C1CC[C@H]([C@@H](C1)NCC2=CC=CC=C2)NCC3=CC=CC=C3
Found 5 products.