CAS 14348-40-4
:3-Hydroxy-2,4,6-tribromobenzoic acid
Description:
3-Hydroxy-2,4,6-tribromobenzoic acid, with the CAS number 14348-40-4, is a brominated aromatic compound characterized by the presence of three bromine atoms and a hydroxyl group attached to a benzoic acid structure. This compound typically exhibits high reactivity due to the electron-withdrawing nature of the bromine substituents, which can influence its acidity and reactivity in various chemical reactions. The hydroxyl group contributes to its potential as a phenolic compound, enhancing its solubility in polar solvents. Additionally, the presence of multiple bromine atoms can impart significant biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The compound may also exhibit unique thermal and spectral properties, which can be studied using techniques such as NMR and IR spectroscopy. Overall, 3-Hydroxy-2,4,6-tribromobenzoic acid is a complex molecule with diverse applications and implications in chemical research and industry.
Formula:C7H2Br3O3
InChI:InChI=1/C7H3Br3O3/c8-2-1-3(9)6(11)5(10)4(2)7(12)13/h1,11H,(H,12,13)/p-1
SMILES:c1c(c(c(c(c1Br)[O-])Br)C(=O)O)Br
Synonyms:- Tbhba
- Rarechem Al Be 1488
- 2,4,6-Tribromo-3-Hydroxy-Benzoicaci
- 2,4,6-Tribromo-3-Hydroxybenzoic Acid
- Labotest-Bb Lt00452434
- Tbhb(3-Hydroxy-2,4,2-TribromobenzoicAcid)
- TbsBuffer,7.6Ph,PowderAndSolutionAvailable
- 3-Hydoxy-2,4,6-Tribromobenzoic Acid
- 2,4,6-Tribromo-3-Hydroxybenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
2,4,6-Tribromo-3-hydroxybenzoic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H2Br3O3Purity:97%Color and Shape:Powder or crystals, White to cream or pale yellowMolecular weight:373.802,4,6-Tribromo-3-hydroxybenzoic acid
CAS:Formula:C7H3Br3O3Purity:98%Color and Shape:SolidMolecular weight:374.80893-Hydroxy-2,4,6-tribromobenzoic acid
CAS:3-Hydroxy-2,4,6-tribromobenzoic acidFormula:C7H3Br3O3Purity:>97%Color and Shape:Solid-PowderMolecular weight:374.808913-Hydroxy-2,4,6-tribromobenzoic acid
CAS:Formula:C7H3Br3O3Purity:≥ 98.0%Color and Shape:White to light yellow powderMolecular weight:374.81TBHBA
CAS:TBHBA blocks COX-2, LOX, 5-LOX, 5-alpha reductase, tyrosinase, and has anti-inflammatory, antioxidant properties.Formula:C7H3Br3O3Purity:98%Color and Shape:White CrystalsMolecular weight:374.8093-Hydroxy-2,4,6-Tribromo-Benzoic Acid (TBHBA), 97%
CAS:Formula:C7H3Br3O3Purity:min. 97%Color and Shape:White, PowderMolecular weight:374.812,4,6-Tribromo-3-hydroxybenzoic acid
CAS:Formula:C7H3Br3O3Purity:98%Color and Shape:SolidMolecular weight:374.813-Hydroxy-2,4,6-tribromobenzoic aicd
CAS:3-Hydroxy-2,4,6-tribromobenzoic acid (3HBBA) is a monocarboxylic acid that inhibits the growth of cancer cells. 3HBBA decreases glucose production by inhibiting peroxidase-like activity in colonic microflora and effective dose. It also has an inhibitory effect on the synthesis of glucose in human serum. 3HBBA was shown to have no effect on plasma glucose levels in healthy subjects at doses up to 1 g/kg body weight. The main metabolic pathways for 3HBBA are beta oxidation and reduction, which can be carried out by both humans and bacteria. 3HBBA is converted into l-tartaric acid (an inhibitor of glycolysis), glycol ethers, and dinucleotide phosphate (a metabolite involved in DNA synthesis).Formula:C7H3Br3O3Purity:Min. 95%Color and Shape:PowderMolecular weight:374.81 g/mol








