CAS 143537-62-6
:N-(B-ketocaproyl)-L-homoserine lactone
Description:
N-(B-ketocaproyl)-L-homoserine lactone, identified by its CAS number 143537-62-6, is a chemical compound that belongs to the class of homoserine lactones, which are known for their role in bacterial quorum sensing. This compound features a lactone structure, which is a cyclic ester formed from the reaction of an alcohol and a carboxylic acid. Its molecular structure includes a ketone functional group and a homoserine moiety, contributing to its biological activity. The presence of the B-ketocaproyl group suggests that it may participate in various biochemical pathways, potentially influencing microbial communication and behavior. This compound is of interest in microbiology and biochemistry due to its implications in regulating gene expression and virulence in certain bacteria. Additionally, its unique structure may offer potential applications in synthetic biology and the development of novel antimicrobial agents. As with many homoserine lactones, it may exhibit varying degrees of stability and reactivity depending on environmental conditions.
Formula:C10H15NO4
InChI:InChI=1/C10H15NO4/c1-2-3-7(12)6-9(13)11-8-4-5-15-10(8)14/h8H,2-6H2,1H3,(H,11,13)/t8-/m0/s1
InChI key:YRYOXRMDHALAFL-QMMMGPOBSA-N
SMILES:CCCC(=O)CC(=N[C@H]1CCOC1=O)O
Synonyms:- N-(Beta-Ketocaproyl)-Dl-Homoserine Lactone
- 3-oxo-N-[(3S)-2-oxotetrahydrofuran-3-yl]hexanamide
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
N-(beta-Ketocaproyl)-L-homoserine Lactone
CAS:Formula:C10H15NO4Purity:>95.0%(qNMR)Molecular weight:213.23N-(β-Ketocaproyl)-L-hoMoserine lactone
CAS:N-(β-Ketocaproyl)-L-hoMoserine lactoneFormula:C10H15NO4Purity:≥98%Molecular weight:213.23(S)-3-Oxo-N-(2-oxotetrahydrofuran-3-yl)hexanamide
CAS:Formula:C10H15NO4Purity:98%Color and Shape:SolidMolecular weight:213.2304N-(β-Ketocaproyl)-L-homoserine lactone
CAS:Formula:C10H15NO4Purity:≥ 98.0%Color and Shape:White solidMolecular weight:213.23N-(3-Oxohexanoyl)-L-homoserine lactone
CAS:(S)-3-Oxo-N-(2-oxotetrahydrofuran-3-yl)hexanamideFormula:C10H15NO4Purity:95%Molecular weight:213.23N-(β-Ketocaproyl)-L-hoMoserine lactone
CAS:N-(beta-Ketocaproyl)-L-hoMoserine lactone (N-(Ketocaproyl)-L-homoserine lactone) is a component of quorum regulatory sensing and an autoinducer of P.Formula:C10H15NO4Purity:99.76%Color and Shape:SolidMolecular weight:213.23(S)-3-Oxo-N-(2-oxotetrahydrofuran-3-yl)hexanamide
CAS:Purity:98%Color and Shape:SolidMolecular weight:213.2330017N-(Ketocaproyl)-L-homoserine Lactone
CAS:Controlled ProductApplications An autoinducer of P. fischeri luciferase. A specific genetic regulator that is unrelated to at least one of the enzyme systems that it induces, and it acts after excretion and accumulation in the extracellular medium.
References Eberhard, A., et al.: Biochemistry, 20, 2444 (1981)Formula:C10H15NO4Color and Shape:NeatMolecular weight:213.23







