CymitQuimica logo

CAS 143537-62-6

:

N-(B-ketocaproyl)-L-homoserine lactone

Description:
N-(B-ketocaproyl)-L-homoserine lactone, identified by its CAS number 143537-62-6, is a chemical compound that belongs to the class of homoserine lactones, which are known for their role in bacterial quorum sensing. This compound features a lactone structure, which is a cyclic ester formed from the reaction of an alcohol and a carboxylic acid. Its molecular structure includes a ketone functional group and a homoserine moiety, contributing to its biological activity. The presence of the B-ketocaproyl group suggests that it may participate in various biochemical pathways, potentially influencing microbial communication and behavior. This compound is of interest in microbiology and biochemistry due to its implications in regulating gene expression and virulence in certain bacteria. Additionally, its unique structure may offer potential applications in synthetic biology and the development of novel antimicrobial agents. As with many homoserine lactones, it may exhibit varying degrees of stability and reactivity depending on environmental conditions.
Formula:C10H15NO4
InChI:InChI=1/C10H15NO4/c1-2-3-7(12)6-9(13)11-8-4-5-15-10(8)14/h8H,2-6H2,1H3,(H,11,13)/t8-/m0/s1
InChI key:YRYOXRMDHALAFL-QMMMGPOBSA-N
SMILES:CCCC(=O)CC(=N[C@H]1CCOC1=O)O
Synonyms:
  • N-(Beta-Ketocaproyl)-Dl-Homoserine Lactone
  • 3-oxo-N-[(3S)-2-oxotetrahydrofuran-3-yl]hexanamide
Found 8 products.