CAS 143612-79-7
:3-(4-Chlorbutyl)-1H-indol-5-carbonitrile
Description:
3-(4-Chlorobutyl)-1H-indol-5-carbonitrile is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a carbonitrile group (-C≡N) at the 5-position of the indole contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The 4-chlorobutyl substituent at the 3-position introduces a halogen and a longer alkyl chain, which can influence the compound's lipophilicity and biological activity. This compound may exhibit various pharmacological properties, making it of interest in drug development. Its molecular interactions, solubility, and stability can be affected by the functional groups present. As with many indole derivatives, it may also participate in various chemical reactions, including nucleophilic substitutions and cyclizations. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds and nitriles.
Formula:C13H13ClN2
InChI:InChI=1S/C13H13ClN2/c14-6-2-1-3-11-9-16-13-5-4-10(8-15)7-12(11)13/h4-5,7,9,16H,1-3,6H2
SMILES:C(CCCl)Cc1c[nH]c2ccc(cc12)C#N
Synonyms:- 3-(4-chlorobutyl)-1H-indole-5-carbonitrile
- Vilazodone Intermediate 8
- 3-(4-Chlorobutyl)indole-5-carbonitrile
- 3-(4-Chlorbutyl)-1H-indol-5-carbonitril
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
3-(4-Chlorobutyl)indole-5-carbonitrile
CAS:Formula:C13H13ClN2Purity:>97.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:232.713-(4-chlorobutyl)-1H-indole-5-carbonitrile
CAS:3-(4-chlorobutyl)-1H-indole-5-carbonitrileFormula:C13H13ClN2Purity:98%Molecular weight:232.713-(4-Chlorbutyl)-1H-indol-5-carbonitril
CAS:Formula:C13H13ClN2Purity:95%Color and Shape:SolidMolecular weight:232.70873-(4-Chlorobutyl)-1H-indole-5-carbonitrile
CAS:Formula:C13H13ClN2Purity:≥ 98.0%Color and Shape:Off-white to yellow or yellow-brown powderMolecular weight:232.713-(4-Chlorobutyl)indole-5-carbonitrile
CAS:Applications Reactant in the preparation of allosteric IGF-1R inhibitors, and dual 5-HT1A receptor agonists and serotonin reuptake inhibitors.
References Heinrich, T. et al.; ACS Med. Chem. Lett., 1, 199 (2010); Heinrich, T. et al.; Bioorg. Med. Chem. 12, 4843 (2004); Heinrich, T. et al.; J. Med. Chem., 47, 4684 (2004)Formula:C13H13ClN2Color and Shape:NeatMolecular weight:232.713-(4-Chlorobutyl)-1H-indole-5-carbonitrile
CAS:Formula:C13H13ClN2Purity:95%Color and Shape:SolidMolecular weight:232.71







