CymitQuimica logo

CAS 143668-57-9

:

N,N'-[(1S,2S)-1,2-diphenyl-1,2-ethanediyl]bis[2-(diphenylphosphino)-BenzaMide

Description:
N,N'-[(1S,2S)-1,2-diphenyl-1,2-ethanediyl]bis[2-(diphenylphosphino)-benzamide], with CAS number 143668-57-9, is a complex organic compound characterized by its unique structural features that include a central diphenyl-ethanediyl moiety and two diphenylphosphino-benzamide groups. This compound typically exhibits properties associated with phosphine ligands, making it relevant in coordination chemistry and catalysis. Its stereochemistry, indicated by the (1S,2S) configuration, suggests that it may exhibit chiral properties, which can influence its reactivity and interactions in various chemical environments. The presence of both phosphine and amide functionalities contributes to its potential as a ligand in metal complexes, enhancing its utility in organic synthesis and catalysis. Additionally, the diphenyl groups provide steric bulk, which can affect the compound's solubility and stability in different solvents. Overall, this compound is of interest in the fields of organometallic chemistry and materials science due to its potential applications in catalysis and as a building block for more complex molecular architectures.
Formula:C52H42N2O2P2
InChI:InChI=1S/C52H42N2O2P2/c55-51(45-35-19-21-37-47(45)57(41-27-11-3-12-28-41)42-29-13-4-14-30-42)53-49(39-23-7-1-8-24-39)50(40-25-9-2-10-26-40)54-52(56)46-36-20-22-38-48(46)58(43-31-15-5-16-32-43)44-33-17-6-18-34-44/h1-38,49-50H,(H,53,55)(H,54,56)/t49-,50-/m0/s1
InChI key:GAVLUHWIRDNCEW-WLTNIFSVSA-N
SMILES:C1=CC=C(C=C1)[C@@H]([C@H](C2=CC=CC=C2)NC(=O)C3=CC=CC=C3P(C4=CC=CC=C4)C5=CC=CC=C5)NC(=O)C6=CC=CC=C6P(C7=CC=CC=C7)C8=CC=CC=C8
Synonyms:
  • diphenylphosphinobenzamide],99%e.e.
  • N,N'-[(1S,2S)-1,2-Diphenyl-1,2-ethanediyl]bis[2-
  • N,N'-[(1S,2S)-1,2-Diphenyl-1,2-ethanediyl]bis[2-diphenylphosphinobenzamide]
  • N,N'-[(1S,2S)-1,2-diphenyl-1,2-ethanediyl]bis[2-(diphenylphosphino)-BenzaMide
  • Benzamide, N,N'-[(1S,2S)-1,2-diphenyl-1,2-ethanediyl]bis[2-(diphenylphosphino)-
Found 4 products.