CymitQuimica logo

CAS 143701-75-1

:

3-cyclopropyl-2-[2-(methylsulfonyl)-4-(trifluoromethyl)benzoyl]-3-oxopropanenitrile

Description:
3-Cyclopropyl-2-[2-(methylsulfonyl)-4-(trifluoromethyl)benzoyl]-3-oxopropanenitrile, identified by its CAS number 143701-75-1, is a synthetic organic compound characterized by its complex structure, which includes a cyclopropyl group, a methylsulfonyl moiety, and a trifluoromethyl-substituted benzoyl group. This compound features a nitrile functional group, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the trifluoromethyl group enhances lipophilicity and may influence biological activity, making it of interest in drug design. The methylsulfonyl group can also impart unique properties, such as increased solubility and stability. Overall, this compound's unique combination of functional groups suggests potential utility in pharmaceutical applications, particularly in the development of novel therapeutic agents. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is studied.
Formula:C15H12F3NO4S
InChI:InChI=1/C15H12F3NO4S/c1-24(22,23)12-6-9(15(16,17)18)4-5-10(12)14(21)11(7-19)13(20)8-2-3-8/h4-6,8,11H,2-3H2,1H3
SMILES:CS(=O)(=O)c1cc(ccc1C(=O)C(C#N)C(=O)C1CC1)C(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.