CymitQuimica logo

CAS 143722-29-6

:

1H-Imidazole-5-carboxaldehyde,1-[(4-bromophenyl)methyl]-2-butyl-4-chloro-

Description:
1H-Imidazole-5-carboxaldehyde, 1-[(4-bromophenyl)methyl]-2-butyl-4-chloro- is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a carboxaldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of a 4-bromophenyl group indicates that it has a bromine substituent on a phenyl ring, which can influence its electronic properties and reactivity. Additionally, the butyl group provides a hydrophobic character, which may affect its solubility in various solvents. The chloro substituent further adds to the compound's complexity and may play a role in its biological activity or interaction with other molecules. Overall, this compound's unique combination of functional groups and structural features suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C15H16BrClN2O
InChI:InChI=1S/C15H16BrClN2O/c1-2-3-4-14-18-15(17)13(10-20)19(14)9-11-5-7-12(16)8-6-11/h5-8,10H,2-4,9H2,1H3
InChI key:DCAOUKIOMHLRBI-UHFFFAOYSA-N
SMILES:CCCCC1=NC(=C(N1CC2=CC=C(C=C2)Br)C=O)Cl
Found 3 products.