CymitQuimica logo

CAS 1438-96-6

:

Cyclohexaneacetic acid, 2-oxo-

Description:
Cyclohexaneacetic acid, 2-oxo- is an organic compound characterized by its cyclohexane ring structure with an acetic acid moiety and a ketone functional group. It typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of both the carboxylic acid and ketone groups contributes to its reactivity, making it a potential intermediate in organic synthesis. This compound is soluble in organic solvents and exhibits moderate polarity due to the functional groups present. Its chemical properties allow it to participate in various reactions, such as esterification and oxidation. Cyclohexaneacetic acid, 2-oxo- may also exhibit biological activity, which can be of interest in pharmaceutical applications. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Proper storage and handling protocols are essential to ensure safety in laboratory and industrial settings.
Formula:C8H12O3
InChI:InChI=1S/C8H12O3/c9-7-4-2-1-3-6(7)5-8(10)11/h6H,1-5H2,(H,10,11)
InChI key:QRUYAODUCVMGQQ-UHFFFAOYSA-N
SMILES:C1CCC(=O)C(C1)CC(=O)O
Found 3 products.