CAS 143807-66-3: 2H-1-Benzopyran-6-carboxylic acid, 3,4-dihydro-5-methyl-, 2-(3,5-dimethylbenzoyl)-2-(1,1-dimethylethyl)hydrazide
Description:2H-1-Benzopyran-6-carboxylic acid, 3,4-dihydro-5-methyl-, 2-(3,5-dimethylbenzoyl)-2-(1,1-dimethylethyl)hydrazide, with CAS number 143807-66-3, is a complex organic compound characterized by its unique structural features, including a benzopyran core and hydrazide functional group. This compound typically exhibits properties associated with both hydrazides and aromatic compounds, such as potential biological activity and solubility in organic solvents. The presence of multiple methyl groups and a bulky tert-butyl group suggests that it may have significant steric hindrance, which can influence its reactivity and interactions with biological targets. Additionally, the carboxylic acid moiety may contribute to its acidity and potential for forming salts or esters. Such compounds are often studied for their pharmacological properties, including anti-inflammatory or anticancer activities. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise values.
Formula:C24H30N2O3
InChI:InChI=1S/C24H30N2O3/c1-15-12-16(2)14-18(13-15)23(28)26(24(4,5)6)25-22(27)20-9-10-21-19(17(20)3)8-7-11-29-21/h9-10,12-14H,7-8,11H2,1-6H3,(H,25,27)
InChI key:InChIKey=HPNSNYBUADCFDR-UHFFFAOYSA-N
SMILES:O=C(NN(C(=O)C=1C=C(C=C(C1)C)C)C(C)(C)C)C2=CC=C3OCCCC3=C2C
- Synonyms:
- 2'-Tert-Butyl-5-Methyl-2'-(3,5-Xyloyl) Chromane-6-Carbohydrazide
- 2H-1-Benzopyran-6-carboxylic acid, 3,4-dihydro-5-methyl-, 2-(3,5-dimethylbenzoyl)-2-(1,1-dimethylethyl)hydrazide
- 3,4-Dihydro-5-Methyl-2H-1-benzopyran-6-carboxylic Acid 2-(3,5-DiMethylbenzoyl)-2-(1,1-diMethylethyl)hydrazide
- Ans-118
- Carbochrozide
- Chromafenozide (Bsi, Pa Iso)
- Cm 001
- Killat
- Matric
- N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-5-methyl-3,4-dihydro-2H-chromene-6-carbohydrazide
- See more synonyms
- Chromafenozide
