CAS 1439899-16-7

1-[[4-(Trifluoromethyl)phenyl]methyl]-1H-imidazole-4-methanamine

Description:

1-[[4-(Trifluoromethyl)phenyl]methyl]-1H-imidazole-4-methanamine is a chemical compound characterized by its imidazole core, which is a five-membered heterocyclic ring containing two nitrogen atoms. The presence of a trifluoromethyl group on the phenyl ring significantly influences its electronic properties, enhancing lipophilicity and potentially affecting its biological activity. This compound features a methanamine substituent, which introduces an amine functional group, contributing to its reactivity and potential interactions in biological systems. The trifluoromethyl group is known for its ability to modulate the pharmacokinetic properties of compounds, making them more potent or selective in various applications. The compound's structure suggests potential uses in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its unique combination of functional groups may also impart interesting properties such as solubility and stability, which are critical for drug formulation and efficacy. Overall, this compound exemplifies the intricate relationship between molecular structure and function in the realm of organic chemistry.

Formula: C₁₂H₁₂F₃N₃

InChI: InChI=1S/C12H12F3N3/c13-12(14,15)10-3-1-9(2-4-10)6-18-7-11(5-16)17-8-18/h1-4,7-8H,5-6,16H2

InChI key: InChIKey=SCJLPTGEGILOLY-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC=C(CN2C=C(CN)N=C2)C=C1

Synonyms:

• 1-[[4-(Trifluoromethyl)phenyl]methyl]-1H-imidazole-4-methanamine
• 1H-Imidazole-4-methanamine, 1-[[4-(trifluoromethyl)phenyl]methyl]-

(1-{[4-(Trifluoromethyl)phenyl]methyl}-1H-imidazol-4-yl)methanamine

CAS: 1439899-16-7

Formula: C₁₂H₁₂F₃N₃

Purity: >95%

Molecular weight: 255.244

Ref: 10-F096694