CymitQuimica logo

CAS 144104-59-6

:

5-Indolylboronic acid

Description:
5-Indolylboronic acid is an organic compound characterized by the presence of both an indole ring and a boronic acid functional group. It typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols. The indole moiety contributes to its aromatic properties, while the boronic acid group allows for the formation of reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and organic synthesis. This compound is often utilized in the development of pharmaceuticals, particularly in the context of drug design and delivery systems, due to its ability to interact with biological molecules. Additionally, 5-Indolylboronic acid can participate in cross-coupling reactions, which are essential in the formation of carbon-carbon bonds in organic synthesis. Its reactivity and functional versatility make it a valuable building block in the synthesis of more complex organic compounds.
Formula:C8H8BNO2
InChI:InChI=1/C8H8BNO2/c11-9(12)7-1-2-8-6(5-7)3-4-10-8/h1-5,10-12H
InChI key:VHADYSUJZAPXOW-UHFFFAOYSA-N
SMILES:c1cc2c(cc[nH]2)cc1B(O)O
Synonyms:
  • 1H-Indol-5-ylboronic acid
  • 5-Indole Boric Acid
  • 5-Indoylboronic Acid
  • (1H-indol-5-yl)boronic acid
Found 4 products.