CymitQuimica logo

CAS 144292-32-0

:

4-Bromo-2,3-difluorophenol

Description:
4-Bromo-2,3-difluorophenol is an organic compound characterized by the presence of a phenolic hydroxyl group (-OH) and multiple halogen substituents on the aromatic ring. Specifically, it features a bromine atom at the para position and two fluorine atoms at the ortho positions relative to the hydroxyl group. This substitution pattern influences its chemical properties, including its reactivity and polarity. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxyl group, while its halogen substituents can enhance its lipophilicity. 4-Bromo-2,3-difluorophenol may participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, depending on the reaction conditions. Its unique structure makes it of interest in fields such as medicinal chemistry and materials science, where it may serve as a building block for more complex molecules or as a potential intermediate in synthetic pathways. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C6H5BClFO2
InChI:InChI=1/C6H5BClFO2/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3,10-11H
InChI key:JZAVCMMYGSROJP-UHFFFAOYSA-N
SMILES:c1cc(c(cc1B(O)O)Cl)F
Synonyms:
  • 2,3-Difluoro-4-Bromophenol
  • 4-BROMO-2,3-difluorphenol
  • 2,3-Difluoro-4-Bromo Phenol
  • 2FPBr
Found 7 products.