CymitQuimica logo

CAS 1443211-72-0

:

Eleclazine

Description:
Eleclazine, identified by the CAS number 1443211-72-0, is a chemical compound that has garnered attention in pharmaceutical research, particularly for its potential therapeutic applications. It is characterized by its unique molecular structure, which contributes to its biological activity. Eleclazine is primarily studied for its effects on the cardiovascular system, specifically as an antiarrhythmic agent. Its mechanism of action involves modulation of ion channels, which plays a crucial role in cardiac electrical activity. The compound exhibits a favorable pharmacokinetic profile, including absorption, distribution, metabolism, and excretion characteristics that support its efficacy and safety in clinical settings. Additionally, ongoing research is focused on understanding its interactions with other drugs and its long-term effects on patients. As with many pharmaceutical compounds, the specific characteristics, including solubility, stability, and reactivity, are critical for its formulation and therapeutic use. Overall, Eleclazine represents a promising candidate in the field of cardiology, with ongoing studies aimed at elucidating its full potential.
Formula:C21H16F3N3O3
InChI:InChI=1S/C21H16F3N3O3/c22-21(23,24)30-16-5-2-14(3-6-16)15-4-7-18-17(12-15)20(28)27(10-11-29-18)13-19-25-8-1-9-26-19/h1-9,12H,10-11,13H2
InChI key:YNUAEEJQYHYLMS-UHFFFAOYSA-N
SMILES:C1COC2=C(C=C(C=C2)C3=CC=C(C=C3)OC(F)(F)F)C(=O)N1CC4=NC=CC=N4
Found 5 products.