CymitQuimica logo

CAS 144435-06-3

:

Pyrido[2,3-b]pyrazine-2,3-dione, 1,4-dihydro-6-methyl- (9CI)

Description:
Pyrido[2,3-b]pyrazine-2,3-dione, 1,4-dihydro-6-methyl- (9CI), with the CAS number 144435-06-3, is a heterocyclic organic compound characterized by its fused pyridine and pyrazine rings. This compound features a diketone functional group, contributing to its reactivity and potential applications in various chemical reactions. The presence of a methyl group at the 6-position of the pyrazine ring influences its physical and chemical properties, such as solubility and stability. Typically, compounds of this class exhibit biological activity, making them of interest in medicinal chemistry and drug development. The structure allows for potential interactions with biological targets, which can lead to pharmacological effects. Additionally, the compound may exhibit properties such as fluorescence or UV absorbance, depending on its specific electronic structure. Overall, Pyrido[2,3-b]pyrazine-2,3-dione, 1,4-dihydro-6-methyl- is a compound of interest for further research in both synthetic and applied chemistry contexts.
Formula:C8H7N3O2
InChI:InChI=1S/C8H7N3O2/c1-4-2-3-5-6(9-4)11-8(13)7(12)10-5/h2-3H,1H3,(H,10,12)(H,9,11,13)
InChI key:WWJQZVUJFGDORP-UHFFFAOYSA-N
SMILES:CC1=NC2=C(C=C1)NC(=O)C(=O)N2
Synonyms:
  • 6-Methyl-1,4-Dihydropyrido[2,3-B]Pyrazine-2,3-Dione
Found 2 products.