CAS 1445-07-4: Pseudouridine
Description:Pseudouridine is a naturally occurring nucleoside that is a derivative of uridine, distinguished by the presence of a carbon-carbon bond between the ribose sugar and the uracil base, rather than the typical nitrogen-carbon bond found in standard nucleosides. This modification enhances the stability of RNA molecules and is thought to play a role in the regulation of gene expression and the structure of tRNA. Pseudouridine is commonly found in various RNA species, including tRNA and rRNA, and is involved in several biological processes. Its chemical formula is C10H13N2O5, and it has a molecular weight of approximately 225.23 g/mol. Pseudouridine exhibits unique properties such as increased thermal stability and resistance to enzymatic degradation, making it an important molecule in the study of RNA biology and potential therapeutic applications. Additionally, it has been investigated for its role in the modification of RNA in various organisms, contributing to the understanding of RNA function and evolution.
Formula:C9H12N2O6
InChI:InChI=1S/C9H12N2O6/c12-2-4-5(13)6(14)7(17-4)3-1-10-9(16)11-8(3)15/h1,4-7,12-14H,2H2,(H2,10,11,15,16)/t4-,5-,6-,7+/m1/s1
InChI key:InChIKey=PTJWIQPHWPFNBW-GBNDHIKLSA-N
SMILES:O=C1NC=C(C(=O)N1)C2OC(CO)C(O)C2O
- Synonyms:
- (1S)-1,4-anhydro-1-(2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)-D-ribitol
- 1: PN: WO2017201317 SEQID: 1 claimed DNA
- 2,4(1H,3H)-Pyrimidinedione, 5-β-<span class="text-smallcaps">D</span>-ribofuranosyl-
- 5-(β-<span class="text-smallcaps">D</span>-Ribofuranosyl)uracil
- 5-Ribosyluracil
- 5-b-D-ribofuranosyl-2,4(1H,3H)-Pyrimidinedione
- 5-β-<span class="text-smallcaps">D</span>-Ribofuranosyl-2,4(1H,3H)-pyrimidinedione
- 5-β-D-ribofuranosyluracil
- B-Pseudouridine
- NSC 162405
- See more synonyms
- Pseudouridine
- Pseudouridine C
- Uracil, 5-β-<span class="text-smallcaps">D</span>-ribofuranosyl-
- β-<span class="text-smallcaps">D</span>-Pseudouridine
- ψ-Uridine
- Uracil, 5-β-D-ribofuranosyl-
- 2,4(1H,3H)-Pyrimidinedione, 5-β-D-ribofuranosyl-
