CymitQuimica logo

CAS 144511-13-7

:

6,9-Difluorobenz[g]isoquinoline-5,10-dione

Description:
6,9-Difluorobenz[g]isoquinoline-5,10-dione is a synthetic organic compound characterized by its unique bicyclic structure, which incorporates both isoquinoline and dione functionalities. This compound features two fluorine atoms positioned at the 6 and 9 positions of the benz[g]isoquinoline framework, contributing to its chemical reactivity and potential biological activity. The presence of the dione functional groups at the 5 and 10 positions enhances its ability to participate in various chemical reactions, including nucleophilic additions and cycloadditions. The fluorine substituents can influence the compound's electronic properties, potentially affecting its solubility, stability, and interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific applications and behavior in biological systems would depend on further studies, including its synthesis, characterization, and evaluation of its biological activity. Overall, 6,9-Difluorobenz[g]isoquinoline-5,10-dione represents a valuable compound for research in organic and medicinal chemistry.
Formula:C13H5F2NO2
InChI:InChI=1S/C13H5F2NO2/c14-8-1-2-9(15)11-10(8)12(17)6-3-4-16-5-7(6)13(11)18/h1-5H
InChI key:SCOHHAVQFVXLPO-UHFFFAOYSA-N
SMILES:C1=CC(=C2C(=C1F)C(=O)C3=C(C2=O)C=NC=C3)F
Synonyms:
  • 6,9-Difluorobenzoisoquinoline-5,10-Dione
  • Benz[g]isoquinoline-5,10-dione, 6,9-difluoro-
Found 4 products.