CymitQuimica logo

CAS 144542-43-8

:

4-Oxazolidinecarboxylicacid,2-oxo-,methylester,(4R)-

Description:
4-Oxazolidinecarboxylic acid, 2-oxo-, methyl ester, (4R)-, is a chemical compound characterized by its oxazolidine ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. This compound features a carboxylic acid functional group and a methyl ester, contributing to its reactivity and potential applications in organic synthesis. The (4R) designation indicates the specific stereochemistry at the chiral center, which can influence the compound's biological activity and interactions. Typically, compounds of this nature may exhibit properties such as solubility in polar solvents, moderate stability under standard conditions, and potential reactivity with nucleophiles due to the presence of the carbonyl and ester functionalities. Such compounds are often explored in medicinal chemistry for their potential as intermediates in the synthesis of pharmaceuticals or as building blocks in the development of biologically active molecules. The specific characteristics, including melting point, boiling point, and spectral data, would require experimental determination or reference to detailed chemical databases.
Formula:C5H7NO4
InChI:InChI=1S/C5H7NO4/c1-9-4(7)3-2-10-5(8)6-3/h3H,2H2,1H3,(H,6,8)/t3-/m1/s1
InChI key:PZIWTVKXOORXAZ-GSVOUGTGSA-N
SMILES:COC(=O)[C@H]1COC(=O)N1
Found 4 products.