CymitQuimica logo

CAS 1446-24-8

:

Phenol, 3-(2-propenyl)-

Description:
Phenol, 3-(2-propenyl)-, also known as allylphenol, is an organic compound characterized by a phenolic structure with an allyl group attached to the aromatic ring. It is a colorless to pale yellow liquid with a distinctive odor. This compound is soluble in organic solvents and exhibits limited solubility in water due to the hydrophobic nature of the allyl group. Allylphenol is known for its antimicrobial properties and is often used in the synthesis of various chemical intermediates, including fragrances and pharmaceuticals. It can undergo typical electrophilic aromatic substitution reactions, making it a versatile building block in organic synthesis. Additionally, it may participate in polymerization reactions due to the presence of the allyl group, which can lead to the formation of larger, more complex molecules. Safety considerations include its potential irritant effects on skin and mucous membranes, necessitating appropriate handling precautions in laboratory and industrial settings.
Formula:C9H10O
InChI:InChI=1S/C9H10O/c1-2-4-8-5-3-6-9(10)7-8/h2-3,5-7,10H,1,4H2
InChI key:PSXBTXZCQRAZGM-UHFFFAOYSA-N
SMILES:C=CCC1=CC(=CC=C1)O
Synonyms:
  • 3-allylphenol
  • Phenol, 3-(2-propen-1-yl)-
Found 4 products.