CymitQuimica logo

CAS 1447607-42-2

:

5-Pyrimidinecarboxylic acid, 2-(4-piperidinyl)-, hydrochloride (1:1)

Description:
5-Pyrimidinecarboxylic acid, 2-(4-piperidinyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrimidine and piperidine moieties, which contribute to its biological activity and potential pharmacological applications. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions, while the hydrochloride form suggests enhanced solubility in water, making it suitable for various formulations. This compound may exhibit properties such as being a potential ligand for biological targets, and its structure suggests it could interact with neurotransmitter systems, possibly influencing central nervous system activity. The hydrochloride salt form typically enhances stability and bioavailability. As with many compounds containing nitrogen heterocycles, it may also display diverse reactivity patterns, including the ability to form hydrogen bonds, which can be crucial for its interaction with biological macromolecules. Overall, this compound's unique structural features position it as a candidate for further research in medicinal chemistry and drug development.
Formula:C10H13N3O2·ClH
InChI:InChI=1S/C10H13N3O2.ClH/c14-10(15)8-5-12-9(13-6-8)7-1-3-11-4-2-7;/h5-7,11H,1-4H2,(H,14,15);1H
InChI key:InChIKey=AKNAFXYFJWVRNI-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=NC(=NC1)C2CCNCC2.Cl
Synonyms:
  • 5-Pyrimidinecarboxylic acid, 2-(4-piperidinyl)-, hydrochloride (1:1)
Found 1 products.