CymitQuimica logo

CAS 14482-32-7

:

Benzenethiol, 2-amino-4-methoxy-

Description:
Benzenethiol, 2-amino-4-methoxy- is an organic compound characterized by the presence of a thiol (-SH) group, an amino (-NH2) group, and a methoxy (-OCH3) group attached to a benzene ring. The compound features a benzene core, which contributes to its aromatic properties, while the amino and methoxy substituents influence its reactivity and solubility. The presence of the thiol group imparts distinct chemical properties, including the ability to form disulfide bonds and participate in redox reactions. This compound is typically a colorless to pale yellow liquid with a characteristic odor, and it is soluble in organic solvents. Its functional groups make it a potential candidate for various applications in organic synthesis, pharmaceuticals, and as a reagent in chemical reactions. Additionally, the compound's structure suggests it may exhibit biological activity, making it of interest in medicinal chemistry. Safety precautions should be observed when handling this substance due to its potential toxicity and reactivity.
Formula:C7H9NOS
InChI:InChI=1S/C7H9NOS/c1-9-5-2-3-7(10)6(8)4-5/h2-4,10H,8H2,1H3
InChI key:KIDLBEYNOGVICH-UHFFFAOYSA-N
SMILES:COC1=CC(=C(C=C1)S)N
Found 3 products.