CymitQuimica logo

CAS 14486-52-3

:

1H-Imidazole, 1-methyl-2-(methylthio)-

Description:
1H-Imidazole, 1-methyl-2-(methylthio)-, with the CAS number 14486-52-3, is a heterocyclic organic compound characterized by its imidazole ring structure, which consists of two nitrogen atoms and three carbon atoms. This compound features a methyl group and a methylthio group attached to the imidazole ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. The presence of the methylthio group enhances its reactivity and solubility in various organic solvents. 1H-Imidazole derivatives are known for their biological activity, often serving as intermediates in the synthesis of pharmaceuticals and agrochemicals. The compound may exhibit properties such as antimicrobial or antifungal activity, making it of interest in medicinal chemistry. Additionally, its structure allows for potential interactions with biological systems, which can be explored for various applications in drug development and material science. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C5H8N2S
InChI:InChI=1S/C5H8N2S/c1-7-4-3-6-5(7)8-2/h3-4H,1-2H3
InChI key:LKIVEIAXFZBGMO-UHFFFAOYSA-N
SMILES:CN1C=CN=C1SC
Synonyms:
  • 1-Methyl-2-(Methylthio)Imidazole
Found 11 products.