CymitQuimica logo

CAS 1449008-04-1

:

6-Chloro-2-fluoro-3-iodobenzaldehyde

Description:
6-Chloro-2-fluoro-3-iodobenzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features three halogen substituents: chlorine, fluorine, and iodine, positioned at the 6, 2, and 3 positions of the benzene ring, respectively. The presence of these halogens significantly influences its chemical reactivity and physical properties, such as solubility and boiling point. The compound is typically a solid at room temperature and may exhibit a distinct odor due to the aldehyde group. It is often used in synthetic organic chemistry as an intermediate for the preparation of more complex molecules, including pharmaceuticals and agrochemicals. The halogen atoms can participate in various reactions, such as nucleophilic substitutions or coupling reactions, making this compound valuable in medicinal chemistry and materials science. Safety precautions should be taken when handling this substance, as halogenated compounds can be toxic and may pose environmental hazards.
Formula:C7H3ClFIO
InChI:InChI=1S/C7H3ClFIO/c8-5-1-2-6(10)7(9)4(5)3-11/h1-3H
InChI key:InChIKey=IDQBKTAWWPXAPN-UHFFFAOYSA-N
SMILES:C(=O)C1=C(F)C(I)=CC=C1Cl
Synonyms:
  • 6-Chloro-2-fluoro-3-iodobenzaldehyde
  • Benzaldehyde, 6-chloro-2-fluoro-3-iodo-
Found 4 products.