CAS 144912-63-0
:Perzinfotel
Description:
Perzinfotel, with the CAS number 144912-63-0, is a chemical compound that has garnered attention in the field of medicinal chemistry, particularly for its potential applications in treating neurological disorders. It is classified as a selective antagonist of the NMDA (N-methyl-D-aspartate) receptor, which plays a crucial role in synaptic plasticity and memory function. The compound's mechanism of action involves modulating glutamatergic neurotransmission, which can be beneficial in conditions characterized by excitotoxicity, such as Alzheimer's disease and other neurodegenerative disorders. Perzinfotel has been studied for its neuroprotective properties, and its pharmacological profile suggests a favorable safety and efficacy balance. Additionally, its chemical structure features specific functional groups that contribute to its binding affinity and selectivity for the NMDA receptor. Ongoing research continues to explore its therapeutic potential and the broader implications of NMDA receptor modulation in various neurological conditions.
Formula:C9H13N2O5P
InChI:InChI=1S/C9H13N2O5P/c12-8-6-7(9(8)13)11(3-1-2-10-6)4-5-17(14,15)16/h10H,1-5H2,(H2,14,15,16)
InChI key:InChIKey=BDABGOLMYNHHTR-UHFFFAOYSA-N
SMILES:C(CP(=O)(O)O)N1C2=C(C(=O)C2=O)NCCC1
Synonyms:- 2,6-Diazabicyclo[5.2.0]nonane, phosphonic acid deriv.
- Eaa-090
- P-[2-(8,9-Dioxo-2,6-diazabicyclo[5.2.0]non-1(7)-en-2-yl)ethyl]phosphonic acid
- Perzinfotel
- Phosphonic acid, P-[2-(8,9-dioxo-2,6-diazabicyclo[5.2.0]non-1(7)-en-2-yl)ethyl]-
- Phosphonic acid, [2-(8,9-dioxo-2,6-diazabicyclo[5.2.0]non-1(7)-en-2-yl)ethyl]-
- Way-126090
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2-(8,9-Dioxo-2,6-diazabicyclo[5.2.0]non-1(7)-en-2-yl)ethyl)phosphonic acid
CAS:(2-(8,9-Dioxo-2,6-diazabicyclo[5.2.0]non-1(7)-en-2-yl)ethyl)phosphonic acidFormula:C9H13N2O5PPurity:99%Molecular weight:260.19(2-(8,9-Dioxo-2,6-diazabicyclo(5.2.0)non-1(7)-en-2-yl)ethyl)phosphonic acid
CAS:(2-(8,9-Dioxo-2,6-diazabicyclo(5.2.0)non-1(7)-en-2-yl)ethyl)phosphonic acid is a potent inhibitor of protein kinases that play a crucial role in the regulation of cell cycle and apoptosis. This compound has shown promising results in inhibiting cancer cell growth both in vitro and in vivo. It has been tested on human urine and Chinese hamster ovary cells lines, and it has demonstrated significant antitumor activity against various types of cancer. (2-(8,9-Dioxo-2,6-diazabicyclo(5.2.0)non-1(7)-en-2-yl)ethyl)phosphonic acid works by blocking the activity of specific kinases involved in tumor progression and metastasis. This medicinal compound is an exciting prospect for developing new inhibitors for cancer treatment.Formula:C9H13N2O5PPurity:Min. 95%Molecular weight:260.18 g/molPerzinfotel
CAS:Perzinfotel is a selective NMDA antagonist; IC50=34 nM; neuroprotective agent; used for stroke and pain research.Formula:C9H13N2O5PPurity:98.35%Color and Shape:Yellow SolidMolecular weight:260.18Ref: TM-T16473
1mgTo inquire5mgTo inquire10mgTo inquire1mL*10mM (DMSO)To inquire25mg553.00€50mg867.00€



