CAS 1449135-43-6
:1,3-Dimethyl-5-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-thienyl]methylene]-2,4,6(1H,3H,5H)-pyrimidinetrione
Description:
1,3-Dimethyl-5-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-thienyl]methylene]-2,4,6(1H,3H,5H)-pyrimidinetrione, identified by its CAS number 1449135-43-6, is a complex organic compound featuring a pyrimidinetrione core, which is characterized by a six-membered ring containing nitrogen atoms and multiple carbonyl groups. The presence of dimethyl groups indicates that it has two methyl substituents, enhancing its lipophilicity and potentially influencing its biological activity. The compound also contains a thienyl group, which introduces sulfur into the structure, contributing to its electronic properties and reactivity. Additionally, the incorporation of a boron-containing moiety, specifically a tetramethyl-1,3,2-dioxaborolane, suggests potential applications in organoboron chemistry, possibly for use in cross-coupling reactions or as a reagent in organic synthesis. Overall, this compound's unique structural features may confer interesting chemical properties and potential applications in medicinal chemistry or materials science.
Formula:C17H21BN2O5S
InChI:InChI=1S/C17H21BN2O5S/c1-16(2)17(3,4)25-18(24-16)12-8-7-10(26-12)9-11-13(21)19(5)15(23)20(6)14(11)22/h7-9H,1-6H3
InChI key:InChIKey=ACWASRSLONUFLW-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2SC(C=C3C(=O)N(C)C(=O)N(C)C3=O)=CC2
Synonyms:- 1,3-Dimethyl-5-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-thienyl]methylene]-2,4,6(1H,3H,5H)-pyrimidinetrione
- 2,4,6(1H,3H,5H)-Pyrimidinetrione, 1,3-dimethyl-5-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-thienyl]methylene]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3-Dimethyl-5-[5-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-thiophen-2-ylmethylene]-pyrimidine-2,4,6-trione
CAS:Formula:C17H21BN2O5SMolecular weight:376.235
