CAS 144978-35-8
:1-Boc-D-Pyroglutamic Acid Ethyl Ester
Description:
1-Boc-D-Pyroglutamic Acid Ethyl Ester, with the CAS number 144978-35-8, is a chemical compound characterized by its structure, which includes a Boc (tert-butyloxycarbonyl) protecting group attached to the nitrogen of the pyroglutamic acid moiety. This compound is an ester, indicating that it is formed from the reaction of an alcohol (in this case, ethanol) with a carboxylic acid (pyroglutamic acid). The presence of the Boc group makes it particularly useful in peptide synthesis, as it protects the amino group during various chemical reactions. The ethyl ester form enhances its solubility in organic solvents, facilitating its use in synthetic applications. 1-Boc-D-Pyroglutamic Acid Ethyl Ester is typically utilized in the field of medicinal chemistry and peptide research, where it serves as an intermediate in the synthesis of more complex molecules. Its stability under standard laboratory conditions and reactivity under specific conditions make it a valuable compound in organic synthesis.
Formula:C12H19NO5
InChI:InChI=1/C12H19NO5/c1-5-17-10(15)8-6-7-9(14)13(8)11(16)18-12(2,3)4/h8H,5-7H2,1-4H3/t8-/m1/s1
SMILES:CCOC(=O)[C@H]1CCC(=O)N1C(=O)OC(C)(C)C
Synonyms:- Ethyl Boc-D-Pyroglutamate
- (R)-5-Oxo-pyrrolidine-1,2-dicarboxylic acid 1-tert-butyl ester 2-ethyl ester
- 1-tert-butyl 2-ethyl (2R)-5-oxopyrrolidine-1,2-dicarboxylate
- BOC-D-Pyr Oet
- BOC-D-Pyroglutamic acid ethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethyl N-(tert-Butoxycarbonyl)-D-pyroglutamate
CAS:Formula:C12H19NO5Purity:>95.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:257.291,2-Pyrrolidinedicarboxylic acid, 5-oxo-, 1-(1,1-dimethylethyl) 2-ethyl ester, (2R)-
CAS:Formula:C12H19NO5Purity:97%Color and Shape:SolidMolecular weight:257.2830Ethyl N-(Tert-Butoxycarbonyl)-D-Pyroglutamate
CAS:Ethyl N-(Tert-Butoxycarbonyl)-D-PyroglutamateFormula:C12H19NO5Purity:98%Color and Shape:SolidMolecular weight:257.28Boc-D-Pyr-OEt
CAS:1-Boc-D-Pyroglutamic acid ethyl esterFormula:C12H19NO5Purity:97%Molecular weight:257.281-Boc-D-Pyroglutamic acid ethyl ester
CAS:Formula:C12H19NO5Purity:97%Color and Shape:SolidMolecular weight:257.286




