CymitQuimica logo

CAS 145122-43-6

:

2,2-Dimethyl-(2-tetrahydrofurylidene)-1,3-dioxane-4,6-dione

Description:
2,2-Dimethyl-(2-tetrahydrofurylidene)-1,3-dioxane-4,6-dione, with CAS number 145122-43-6, is a chemical compound characterized by its unique structural features, including a dioxane ring and a tetrahydrofurylidene moiety. This compound typically exhibits a stable, crystalline form and is soluble in organic solvents, which is common for many dioxane derivatives. Its molecular structure suggests potential reactivity due to the presence of the dioxane dione functional groups, which may participate in various chemical reactions, including nucleophilic attacks and cyclization processes. The presence of the dimethyl and tetrahydrofurylidene groups may influence its physical properties, such as melting point and boiling point, as well as its reactivity and interaction with other substances. Additionally, compounds of this nature may have applications in organic synthesis, pharmaceuticals, or materials science, although specific applications would depend on further research into its properties and reactivity. Safety data and handling precautions should be consulted due to the potential hazards associated with chemical compounds.
Formula:C10H12O5
InChI:InChI=1/C10H12O5/c1-10(2)14-8(11)7(9(12)15-10)6-4-3-5-13-6/h3-5H2,1-2H3
InChI key:JSUMRUSDCOEXFQ-UHFFFAOYSA-N
SMILES:CC1(C)OC(=O)C(=C2CCCO2)C(=O)O1
Synonyms:
  • 5-(dihydrofuran-2(3H)-ylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione
Found 3 products.