CymitQuimica logo

CAS 145162-36-3

:

1H-Pyrrole-2-carboxylicacid,3-amino-4-cyano-1-methyl-,ethylester(9CI)

Description:
1H-Pyrrole-2-carboxylic acid, 3-amino-4-cyano-1-methyl-, ethyl ester, identified by CAS number 145162-36-3, is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a carboxylic acid functional group, an amino group, and a cyano group, contributing to its reactivity and potential biological activity. The ethyl ester moiety enhances its solubility in organic solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. The presence of multiple functional groups suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. Additionally, compounds with similar structures are often investigated for their pharmacological properties, including anti-inflammatory and antimicrobial activities. Overall, 1H-Pyrrole-2-carboxylic acid derivatives are of interest in both synthetic and medicinal chemistry due to their diverse reactivity and potential therapeutic applications.
Formula:C9H11N3O2
InChI:InChI=1S/C9H11N3O2/c1-3-14-9(13)8-7(11)6(4-10)5-12(8)2/h5H,3,11H2,1-2H3
InChI key:LXXYJUNJQOUNHJ-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=C(C(=CN1C)C#N)N
Found 3 products.