CAS 145240-28-4
:4-n-Butylbenzeneboronic acid
Description:
4-n-Butylbenzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a butyl-substituted phenyl ring. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents, such as methanol and ethanol, due to its polar boronic acid group. It exhibits properties typical of boronic acids, including the ability to form reversible complexes with diols, which makes it useful in various applications, particularly in organic synthesis and medicinal chemistry. The presence of the butyl group enhances its lipophilicity, potentially influencing its reactivity and solubility in biological systems. Additionally, 4-n-Butylbenzeneboronic acid can participate in Suzuki-Miyaura cross-coupling reactions, making it valuable for constructing carbon-carbon bonds in the synthesis of complex organic molecules. Its reactivity and functional versatility make it a significant compound in the development of pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C10H15BO2
InChI:InChI=1/C10H15BO2/c1-2-3-4-9-5-7-10(8-6-9)11(12)13/h5-8,12-13H,2-4H2,1H3
SMILES:CCCCc1ccc(cc1)B(O)O
Synonyms:- 4-n-Butylphenylboronic acid
- 4-Butylphenylboronic acid
- (4-Butylphenyl)Boronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Butylphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C10H15BO2Color and Shape:White to Orange to Green powder to crystalMolecular weight:178.044-(But-1-yl)benzeneboronic acid
CAS:4-(But-1-yl)benzeneboronic acidFormula:C10H15BO2Purity:98%Color and Shape:White to off white Solid-PowderMolecular weight:178.0359Boronic acid, B-(4-butylphenyl)-
CAS:Formula:C10H15BO2Purity:98%Color and Shape:SolidMolecular weight:178.03594-n-Butylphenylboronic acid
CAS:Formula:C10H15BO2Purity:98%Color and Shape:Solid, White powderMolecular weight:178.044-(But-1-yl)benzeneboronic acid
CAS:4-Butylphenylboronic acidFormula:C10H15BO2Purity:98%Molecular weight:178.04





