CymitQuimica logo

CAS 145293-21-6

:

[2-(4-AMINO-PHENYL)-THIAZOL-4-YL]-METHANOL

Description:
[2-(4-Amino-phenyl)-thiazol-4-yl]-methanol, with the CAS number 145293-21-6, is a chemical compound characterized by its thiazole and amino phenyl functional groups. The thiazole ring contributes to its heterocyclic nature, which can influence its reactivity and biological activity. The presence of the amino group suggests potential for hydrogen bonding and interactions with biological targets, making it of interest in medicinal chemistry. The methanol moiety indicates that the compound may exhibit solubility in polar solvents, which can affect its pharmacokinetics and bioavailability. Additionally, the structural features may impart specific electronic properties, influencing its behavior in chemical reactions. Overall, this compound may have applications in pharmaceuticals or as a research tool, particularly in studies related to its biological activity or as a precursor in synthetic chemistry. Further investigation into its properties, such as stability, reactivity, and potential applications, would be necessary to fully understand its utility in various fields.
Formula:C10H10N2OS
InChI:InChI=1S/C10H10N2OS/c11-8-3-1-7(2-4-8)10-12-9(5-13)6-14-10/h1-4,6,13H,5,11H2
InChI key:IVCTTYLPCHIYFW-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C2=NC(=CS2)CO)N
Found 1 products.