CAS 14590-53-5
:(+)-2,2-Dimethylcyclopropanecarboxylic acid
Description:
(+)-2,2-Dimethylcyclopropanecarboxylic acid, with the CAS number 14590-53-5, is a chiral organic compound characterized by its cyclopropane ring structure, which is substituted with two methyl groups and a carboxylic acid functional group. This compound exhibits unique stereochemistry due to the presence of the chiral center, influencing its reactivity and interactions in chemical processes. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the steric hindrance introduced by the two methyl groups can affect the compound's reactivity and stability. (+)-2,2-Dimethylcyclopropanecarboxylic acid is of interest in organic synthesis and may have applications in pharmaceuticals and agrochemicals, where its unique structure can contribute to the development of novel compounds with specific biological activities.
Formula:C6H10O2
InChI:InChI=1S/C6H10O2/c1-6(2)3-4(6)5(7)8/h4H,3H2,1-2H3,(H,7,8)/t4-/m1/s1
InChI key:InChIKey=BFNMOMYTTGHNGJ-SCSAIBSYSA-N
SMILES:C(O)(=O)[C@@H]1C(C)(C)C1
Synonyms:- (+)-2,2-Dimethylcyclopropanecarboxylic acid
- (1S)-2,2-Dimethylcyclopropane-1-carboxylic acid
- (1S)-2,2-dimethylcyclopropanecarboxylic acid
- (S)-(+)-2,2-Dimethylcyclopropanecarboxylic acid
- (S)-(+)-Dmcpca
- Cyclopropanecarboxylic acid, 2,2-dimethyl-, (+)-
- Cyclopropanecarboxylic acid, 2,2-dimethyl-, (1S)-
- Cyclopropanecarboxylic acid, 2,2-dimethyl-, (S)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Cyclopropanecarboxylic acid, 2,2-dimethyl-, (1S)-
CAS:Formula:C6H10O2Purity:95%Color and Shape:LiquidMolecular weight:114.1424(S)-(+)-2,2-Dimethylcyclopropanecarboxylic acid
CAS:(S)-(+)-2,2-Dimethylcyclopropanecarboxylic acidFormula:C6H10O2Purity:97%Molecular weight:114.1424(S)-(+)-2,2-Dimethylcyclopropanecarboxylic Acid
CAS:(S)-2,2-Dimethylcyclopropanecarboxylic acidFormula:C6H10O2Purity:97%Molecular weight:114.14(S)-2,2-Dimethylcyclopropanecarboxylic acid
CAS:Formula:C6H10O2Purity:97%Color and Shape:LiquidMolecular weight:114.144(S)-(+)-2,2-Dimethylcyclopropanecarboxylic acid
CAS:(S)-(+)-2,2-Dimethylcyclopropanecarboxylic acid is an organic compound with a chiral center. It can be isolated from natural sources or synthesized in the laboratory. This compound has been used as a solvent and reaction system for organic reactions. (S)-(+)-2,2-Dimethylcyclopropanecarboxylic acid is also a carboxylate that can be hydrolyzed by esterases to form the corresponding alcohol and carboxylic acid. It is hydrophobic and lipophilic, which makes it useful in isolating compounds from reaction solution. (S)-(+)-2,2-Dimethylcyclopropanecarboxylic acid has been shown to have enzyme specificity for lipases and cilastatin.br> br>Formula:C6H10O2Purity:Min. 95%Molecular weight:114.14 g/mol




