CAS 145903-06-6
:4-[3-(4-Benzylpiperidin-1-yl)propionyl]-7-methoxy-2,3,4,5-tetrahydro-1,4-benzothiazepine
Description:
4-[3-(4-Benzylpiperidin-1-yl)propionyl]-7-methoxy-2,3,4,5-tetrahydro-1,4-benzothiazepine, with CAS number 145903-06-6, is a synthetic compound that belongs to the class of benzothiazepines, which are characterized by a fused benzene and thiazepine ring structure. This compound features a methoxy group and a piperidine moiety, contributing to its potential pharmacological properties. The presence of the benzyl group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its structural complexity may influence its solubility, stability, and bioavailability. The compound's specific characteristics, such as melting point, boiling point, and solubility, would typically be determined through experimental methods. Additionally, its biological activity, including receptor binding affinity and efficacy, would be evaluated through pharmacological studies. Overall, this compound represents a unique structure that may have implications in drug development, particularly in the context of neurological or psychiatric disorders, although further research would be necessary to elucidate its full potential.
Formula:C25H32N2O2S
InChI:InChI=1S/C25H32N2O2S/c1-29-23-7-8-24-22(18-23)19-27(15-16-30-24)25(28)11-14-26-12-9-21(10-13-26)17-20-5-3-2-4-6-20/h2-8,18,21H,9-17,19H2,1H3
InChI key:InChIKey=KCWGETCFOVJEPI-UHFFFAOYSA-N
SMILES:C(CCN1CCC(CC2=CC=CC=C2)CC1)(=O)N3CC=4C(=CC=C(OC)C4)SCC3
Synonyms:- 1,4-Benzothiazepine, 2,3,4,5-tetrahydro-7-methoxy-4-[1-oxo-3-[4-(phenylmethyl)-1-piperidinyl]propyl]-
- 1-(2,3-Dihydro-7-methoxy-1,4-benzothiazepin-4(5H)-yl)-3-[4-(phenylmethyl)-1-piperidinyl]-1-propanone
- 1-Propanone, 1-(2,3-dihydro-7-methoxy-1,4-benzothiazepin-4(5H)-yl)-3-[4-(phenylmethyl)-1-piperidinyl]-
- 4-[3-[1-(4-Benzyl)piperidinyl]propionyl]-7-methoxy-2,3,4,5-tetrahydro-1,4-benzothiazepine
- Jtv-519
- K-201
- 4-[3-(4-Benzylpiperidin-1-yl)propionyl]-7-methoxy-2,3,4,5-tetrahydro-1,4-benzothiazepine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
JTV-519 hemifumarate
CAS:<p>JTV-519 hemifumarate is a calcium sensitizer, which is a pharmaceutical agent designed to improve cardiac contractility. It is derived from a synthetic process focusing on modulating calcium dynamics within cardiac cells. By binding to and stabilizing the ryanodine receptor (RyR2), JTV-519 hemifumarate enhances calcium release from the sarcoplasmic reticulum during the cardiac cycle. This action leads to an increase in the sensitivity of cardiac myofilaments to calcium without increasing intracellular calcium concentration, thereby improving myocardial contractility without the pro-arrhythmic effects associated with increased calcium transients.</p>Formula:C25H32N2O2S·5C4H4O4Purity:Min. 95%Molecular weight:482.63 g/molJTV-519 free base
CAS:JTV-519 free base (K201 free base), recognized for its antiarrhythmic and cardioprotective properties, functions as a Ca2+-dependent blocker of sarcoplasmicFormula:C25H32N2O2SPurity:98%Color and Shape:SolidMolecular weight:424.6

