CAS 146-77-0: 2-Chloroadenosine
Description:2-Chloroadenosine is a modified nucleoside that consists of an adenine base linked to a ribose sugar, with a chlorine atom substituted at the 2-position of the ribose. Its molecular formula is C10H12ClN5O4, and it has a molecular weight that reflects its composition. This compound is known for its role in biochemical research, particularly in studies related to purinergic signaling and cellular processes. 2-Chloroadenosine can act as an agonist for adenosine receptors, influencing various physiological responses such as vasodilation and neurotransmission. It is often utilized in pharmacological studies to explore the effects of adenosine and its analogs on cellular functions. The presence of the chlorine atom alters the compound's reactivity and biological activity compared to adenosine. Additionally, 2-Chloroadenosine is soluble in water and exhibits stability under physiological conditions, making it a valuable tool in experimental settings. Its unique properties and interactions with biological systems make it significant in both research and potential therapeutic applications.
Formula:C10H12ClN5O4
InChI:InChI=1S/C10H12ClN5O4/c11-10-14-7(12)4-8(15-10)16(2-13-4)9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1H2,(H2,12,14,15)/t3-,5-,6-,9-/m1/s1
InChI key:InChIKey=BIXYYZIIJIXVFW-UUOKFMHZSA-N
SMILES:ClC=1N=C(N)C=2N=CN(C2N1)C3OC(CO)C(O)C3O
- Synonyms:
- 2-Chloradenosinhemihydrat
- 2-Chloro-<span class="text-smallcaps">D</span>-adenosine
- 2-Chloro-D-adenosine
- 2-Chloroadenosine
- 2-Chloroadenosine, hemihydrate
- 2-Chloroadenosinehemihydrate
- 2-Cloroadenosina, Hemihidrato
- Antibiotic AT 265B
- Cado
- Nsc 36896
- See more synonyms
- 6-amino-2-chloropurine riboside
- Adenosine, 2-chloro-
- 2-chloro-9-pentofuranosyl-9H-purin-6-amine
