CAS 14602-93-8

(6aR,12aR)-6H-[1,3]Dioxolo[5,6]benzofuro[3,2-c][1]benzopyran-3,6a(12aH)-diol

Description:

The chemical substance known as (6aR,12aR)-6H-[1,3]Dioxolo[5,6]benzofuro[3,2-c][1]benzopyran-3,6a(12aH)-diol, with the CAS number 14602-93-8, is a complex organic compound characterized by its unique bicyclic structure that incorporates both dioxole and benzopyran moieties. This compound features multiple hydroxyl groups, which contribute to its potential reactivity and solubility in polar solvents. The stereochemistry indicated by the (6aR,12aR) designation suggests specific spatial arrangements of atoms, which can influence its biological activity and interactions with other molecules. Such compounds are often studied for their potential pharmacological properties, including antioxidant and anti-inflammatory effects. The presence of the dioxole ring may also impart unique electronic properties, making it of interest in materials science and organic electronics. Overall, this substance exemplifies the intricate nature of organic chemistry, where structural features play a critical role in determining chemical behavior and potential applications.

Formula: C₁₆H₁₂O₆

InChI: InChI=1S/C16H12O6/c17-8-1-2-9-11(3-8)19-6-16(18)10-4-13-14(21-7-20-13)5-12(10)22-15(9)16/h1-5,15,17-18H,6-7H2/t15-,16+/m1/s1

InChI key: InChIKey=GLMPLZUBQDAZEN-CVEARBPZSA-N

SMILES: O[C@@]12[C@@](C=3C(OC1)=CC(O)=CC3)(OC=4C2=CC5=C(C4)OCO5)[H]

Synonyms:

• 6H-[1,3]Dioxolo[5,6]benzofuro[3,2-c][1]benzopyran-3,6a(12aH)-diol, (6aR,12aR)-
• 6H-[1,3]Dioxolo[5,6]benzofuro[3,2-c][1]benzopyran-3,6a(12aH)-diol, (6aR-cis)-
• (6aR,12aR)-6H-[1,3]Dioxolo[5,6]benzofuro[3,2-c][1]benzopyran-3,6a(12aH)-diol
• (+)-6a-Hydroxymaackiain

6a-Hydroxymaackiain

CAS: 14602-93-8

6a-Hydroxymaackiain is a naturally occurring phytoalexin, which is an antimicrobial compound produced by plants as part of their defense mechanisms against pathogens. This particular compound is typically sourced from leguminous plants, where it is synthesized in response to external stressors such as microbial infection. The mode of action of 6a-Hydroxymaackiain involves disrupting the cell membranes of invading microorganisms, thereby inhibiting their ability to grow and proliferate. This defense strategy allows the plant to resist infection and maintain its overall health.

Formula: C₁₆H₁₂O₆

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 300.26 g/mol

Ref: 3D-XH161543