CAS 14602-93-8: (6aR,12aR)-6H-[1,3]Dioxolo[5,6]benzofuro[3,2-c][1]benzopyran-3,6a(12aH)-diol

Description:The chemical substance known as (6aR,12aR)-6H-[1,3]Dioxolo[5,6]benzofuro[3,2-c][1]benzopyran-3,6a(12aH)-diol, with the CAS number 14602-93-8, is a complex organic compound characterized by its unique bicyclic structure that incorporates both dioxole and benzopyran moieties. This compound features multiple hydroxyl groups, which contribute to its potential reactivity and solubility in polar solvents. The stereochemistry indicated by the (6aR,12aR) designation suggests specific spatial arrangements of atoms, which can influence its biological activity and interactions with other molecules. Such compounds are often studied for their potential pharmacological properties, including antioxidant and anti-inflammatory effects. The presence of the dioxole ring may also impart unique electronic properties, making it of interest in materials science and organic electronics. Overall, this substance exemplifies the intricate nature of organic chemistry, where structural features play a critical role in determining chemical behavior and potential applications.

Formula:C₁₆H₁₂O₆

InChI:InChI=1S/C16H12O6/c17-8-1-2-9-11(3-8)19-6-16(18)10-4-13-14(21-7-20-13)5-12(10)22-15(9)16/h1-5,15,17-18H,6-7H2/t15-,16+/m1/s1

InChI key:InChIKey=GLMPLZUBQDAZEN-CVEARBPZSA-N

SMILES:OC1=CC=C2C(OCC3(O)C4=CC=5OCOC5C=C4OC23)=C1