CymitQuimica logo

CAS 146144-65-2

:

2-Azabicyclo[2.2.2]octane-3-carboxylicacid,(R)-(9CI)

Description:
2-Azabicyclo[2.2.2]octane-3-carboxylic acid, also known by its CAS number 146144-65-2, is a bicyclic compound featuring a nitrogen atom within its ring structure, which classifies it as a bicyclic amine. This compound is characterized by its unique bicyclic framework, which consists of two fused cyclopropane rings and a nitrogen atom, contributing to its rigidity and potential biological activity. The presence of a carboxylic acid functional group at the 3-position enhances its polarity and solubility in polar solvents, making it suitable for various chemical reactions and applications. The (R)-enantiomer indicates that it has a specific three-dimensional arrangement, which can influence its interaction with biological systems, particularly in pharmacology. This compound may be of interest in medicinal chemistry due to its structural features that could mimic neurotransmitters or other biologically active molecules. Overall, 2-Azabicyclo[2.2.2]octane-3-carboxylic acid represents a significant structure in the study of organic compounds with potential therapeutic applications.
Formula:C8H13NO2
InChI:InChI=1S/C8H13NO2/c10-8(11)7-5-1-3-6(9-7)4-2-5/h5-7,9H,1-4H2,(H,10,11)/t5?,6?,7-/m1/s1
InChI key:YDIUZWIFYIATRZ-KPGICGJXSA-N
SMILES:C1CC2CCC1[C@@H](N2)C(=O)O
Found 2 products.