CAS 14615-72-6
:3,5-Dibenzyloxybenzaldehyde
Description:
3,5-Dibenzyloxybenzaldehyde is an organic compound characterized by the presence of two benzyloxy groups attached to a benzaldehyde moiety. Its molecular structure features a benzene ring with aldehyde functionality and two ether linkages, which contribute to its chemical properties. This compound typically appears as a white to light yellow solid and is soluble in organic solvents such as ethanol and dichloromethane, but has limited solubility in water due to its hydrophobic nature. The presence of the benzyloxy groups enhances its stability and can influence its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and fine chemicals. Additionally, 3,5-Dibenzyloxybenzaldehyde may exhibit interesting optical properties and can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Its unique structure and functional groups make it a valuable compound for research and industrial applications in organic chemistry.
Formula:C21H18O3
InChI:InChI=1S/C21H18O3/c22-14-19-11-20(23-15-17-7-3-1-4-8-17)13-21(12-19)24-16-18-9-5-2-6-10-18/h1-14H,15-16H2
InChI key:InChIKey=CHUAMRVJSRBRHT-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=CC(OCC3=CC=CC=C3)=CC(C=O)=C2
Synonyms:- 3,5-Bis(Benzyloxy)Benzaldehyde
- 3,5-Bis(phenylmethoxy)benzaldehyde
- 3,5-Dibenzyloxy Benzaldehyde
- Benzaldehyde, 3,5-bis(benzyloxy)-
- Benzaldehyde, 3,5-bis(phenylmethoxy)-
- 3,5-Dibenzyloxybenzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3,5-Dibenzyloxybenzaldehyde
CAS:Formula:C21H18O3Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:318.373,5-Dibenzyloxybenzaldehyde
CAS:3,5-DibenzyloxybenzaldehydeFormula:C21H18O3Purity:98%Molecular weight:318.37Benzaldehyde, 3,5-bis(phenylmethoxy)-
CAS:Formula:C21H18O3Purity:95%Color and Shape:SolidMolecular weight:318.36583,5-Benzyloxy benzaldehyde
CAS:3,5-Benzyloxy benzaldehydeFormula:C21H18O3Purity:98%Molecular weight:318.365823,5-Dibenzyloxybenzaldehyde
CAS:3,5-Dibenzyloxybenzaldehyde is a molecule that has been shown to induce apoptosis in prostate cancer cells. It binds to the survivin protein and prevents its function. 3,5-Dibenzyloxybenzaldehyde also has anti-cancer properties due to its ability to inhibit the growth of cultured prostate cancer cells in vitro. This compound can be used as a photophysical probe for radiation studies or as a fatty acid monomer for metathesis reactions. The molecule is also active against cox-2 inhibitory activity and has been shown to have clinical efficacy in diazepine synthesis.Formula:C21H18O3Purity:Min. 95%Molecular weight:318.37 g/mol3,5-Dibenzyloxybenzaldehyde
CAS:Controlled ProductFormula:C21H18O3Color and Shape:NeatMolecular weight:318.36






