CAS 14633-31-9
:Benzene, [(4-chlorobutyl)thio]-
Description:
Benzene, [(4-chlorobutyl)thio]- is an organic compound characterized by the presence of a benzene ring substituted with a thioether group, specifically a 4-chlorobutyl moiety. The thioether linkage introduces sulfur into the structure, which can influence the compound's reactivity and physical properties. This compound typically exhibits a relatively low boiling point and moderate solubility in organic solvents, reflecting its aromatic nature and the influence of the alkyl chain. The presence of the chlorine atom can impart additional reactivity, making it a potential candidate for further chemical transformations. As with many chlorinated compounds, it may also exhibit environmental persistence and potential toxicity, necessitating careful handling and consideration in applications. The compound's molecular structure suggests it may be used in various chemical syntheses or as an intermediate in the production of more complex molecules. However, specific safety and regulatory information should be consulted for practical applications.
Formula:C10H13ClS
InChI:InChI=1S/C10H13ClS/c11-8-4-5-9-12-10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2
InChI key:OMSCMJGUCKTCEA-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)SCCCCCl
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
