CAS 146346-81-8
:Fmoc-Ser(BSi)-OH
Description:
Fmoc-Ser(BSi)-OH, or 9-fluorenylmethoxycarbonyl-serine (Benzylsilane), is a protected amino acid commonly used in peptide synthesis. The Fmoc group serves as a protective moiety for the amino group, allowing for selective reactions during the synthesis process. This compound features a serine residue, which contains a hydroxyl group that can participate in various chemical reactions, making it versatile in synthetic applications. The presence of the benzylsilane (BSi) group provides additional protection for the hydroxyl functionality, enhancing the stability of the molecule during synthesis. Fmoc-Ser(BSi)-OH is typically used in solid-phase peptide synthesis (SPPS), where its stability under basic conditions is advantageous. The compound is generally soluble in organic solvents, such as dimethylformamide (DMF) and dichloromethane (DCM), but less soluble in water. Its reactivity and stability make it a valuable building block in the development of peptides and other bioactive compounds in medicinal chemistry and biochemistry. Proper handling and storage conditions are essential to maintain its integrity and effectiveness in synthetic applications.
Formula:C24H31NO5Si
InChI:InChI=1S/C24H31NO5Si/c1-24(2,3)31(4,5)30-15-21(22(26)27)25-23(28)29-14-20-18-12-8-6-10-16(18)17-11-7-9-13-19(17)20/h6-13,20-21H,14-15H2,1-5H3,(H,25,28)(H,26,27)/t21-/m0/s1
InChI key:IONOZYFSQPGBAT-NRFANRHFSA-N
SMILES:CC(C)(C)[Si](C)(C)OC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
Synonyms:- N-Alpha-(9-Fluorenylmethoxycarbonyl)-O-T-Butyldimethylsilyl-L-Serine
- Fmoc-O-T-Butyldimethylsilyl-L-Serine
- Fmoc-Serine(Bsi)-Oh
- Fmoc-Ser(Tbume 2Si)-Oh
- Fmoc-Ser(Tbdms)-Oh
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Fmoc-Ser(BSi)-OH
CAS:The BSi (or TBDMS) ether is somewhat more labile towards TFA than the tBu ether protection of the Ser hydroxyl moiety. Ser(TBDMS) can be cleaaved selectiviely in the presence of Boc/tBu with Bu₄N fluoride in DMF, but Fmoc is removed under these conditions as well.Formula:C24H31NO5SiPurity:99.3%Color and Shape:White PowderMolecular weight:441.6N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-O-(tert-butyldimethylsilyl)-L-serine
CAS:N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-O-(tert-butyldimethylsilyl)-L-serineFormula:C24H31NO5SiPurity:97%Molecular weight:441.59Fmoc-O-tert-butyldimethylsilyl-L-serine
CAS:Fmoc-O-tert-butyldimethylsilyl-L-serine is a monomer that can be used in the solid-phase synthesis of conjugates. It has been shown to be an efficient method for synthesizing bioconjugates, which are used in chemical biology and biotechnology. Fmoc-O-tert-butyldimethylsilyl-L-serine is also efficient for the synthesis of proteins, small organic molecules, and carbohydrates. This monomer is often used as a building block for peptide synthesis because it can be easily removed from the peptides with trifluoroacetic acid or other acid catalysts.
Formula:C24H31NO5SiPurity:Min. 95%Color and Shape:SolidMolecular weight:441.59 g/molFmoc-Ser(TBDMS)-OH
CAS:Controlled ProductApplications Fmoc-Ser(TBDMS)-OH (cas# 146346-81-8) is a useful research chemical.
Formula:C24H31NO5SiColor and Shape:NeatMolecular weight:441.592






