CymitQuimica logo

CAS 146449-90-3

:

(4-PENTYLOXYPHENYL)BORONIC ACID

Description:
(4-Pentyloxyphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a pentyloxy group. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many boronic acids. It is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and materials science. The presence of the pentyloxy group enhances its hydrophobic characteristics, potentially influencing its reactivity and interactions in biological systems. Additionally, boronic acids are often utilized in the development of sensors and in medicinal chemistry due to their ability to interact with biomolecules. Overall, (4-pentyloxyphenyl)boronic acid serves as a versatile building block in synthetic chemistry and has implications in drug development and molecular recognition processes.
Formula:C11H17BO3
InChI:InChI=1S/C11H17BO3/c1-2-3-4-9-15-11-7-5-10(6-8-11)12(13)14/h5-8,13-14H,2-4,9H2,1H3
InChI key:WHFKSJLAGACWMF-UHFFFAOYSA-N
SMILES:B(C1=CC=C(C=C1)OCCCCC)(O)O
Synonyms:
  • 4-(N-Pentyloxy)Benzeneboronic Acid
  • 4-(N-Pentyloxy)Phenylboronic Acid
  • Akos Brn-0164
  • 4-Pentyloxyphenylboronicacid
Found 5 products.