CymitQuimica logo

CAS 146553-06-2

:

N~2~-(tert-butoxycarbonyl)-N-methoxy-N-methylalaninamide

Description:
N~2~-(tert-butoxycarbonyl)-N-methoxy-N-methylalaninamide is a chemical compound characterized by its specific functional groups and structural features. It contains a tert-butoxycarbonyl (Boc) protecting group, which is commonly used in organic synthesis to protect amines during reactions. The presence of methoxy and methyl groups indicates that the compound has both ether and alkyl functionalities, contributing to its overall hydrophobic character. The alaninamide backbone suggests that it is an amino acid derivative, which may impart biological relevance, particularly in peptide synthesis or medicinal chemistry. This compound is likely to be a white to off-white solid, soluble in organic solvents, and may exhibit moderate stability under standard laboratory conditions. Its unique structure allows for potential applications in drug development, particularly in the design of peptide-based therapeutics. As with many chemical substances, handling should be conducted with care, following appropriate safety protocols due to potential reactivity or toxicity.
Formula:C10H20N2O4
InChI:InChI=1/C10H20N2O4/c1-7(8(13)12(5)15-6)11-9(14)16-10(2,3)4/h7H,1-6H3,(H,11,14)/t7-/m1/s1
InChI key:PWQIGBOSLQHOBT-SSDOTTSWSA-N
SMILES:C[C@H](C(=O)N(C)OC)N=C(O)OC(C)(C)C
Found 3 products.