CymitQuimica logo

CAS 146656-95-3

:

1H-Pyrazole-4-carboxylicacid,2,3-dihydro-3-oxo-,methylester(9CI)

Description:
1H-Pyrazole-4-carboxylic acid, 2,3-dihydro-3-oxo-, methyl ester, commonly referred to by its CAS number 146656-95-3, is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a carboxylic acid functional group and a methyl ester, contributing to its reactivity and solubility properties. It typically appears as a solid or liquid, depending on the specific conditions, and is known for its potential applications in pharmaceuticals and agrochemicals due to its bioactive properties. The presence of the dihydro-3-oxo moiety suggests it may exhibit keto-enol tautomerism, influencing its chemical behavior. Additionally, the compound's structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C5H6N2O3
InChI:InChI=1S/C5H6N2O3/c1-10-5(9)3-2-6-7-4(3)8/h2H,1H3,(H2,6,7,8)
InChI key:GAWWMETUNCXVML-UHFFFAOYSA-N
SMILES:COC(=O)C1=CNNC1=O
Found 3 products.