CymitQuimica logo

CAS 146697-87-2

:

1-ETHOXYMETHYL-2-IODOIMIDAZOLE

Description:
1-Ethoxymethyl-2-iodoimidazole is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of an ethoxymethyl group and an iodine atom at specific positions on the imidazole ring contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its iodine substituent can enhance its electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. The ethoxymethyl group may also influence its lipophilicity and biological activity. As with many halogenated compounds, 1-ethoxymethyl-2-iodoimidazole should be handled with care due to potential toxicity and environmental concerns. Proper safety protocols should be followed when working with this substance in laboratory settings. Overall, its structural features suggest potential utility in the development of pharmaceuticals or as an intermediate in synthetic pathways.
Formula:C6H9IN2O
InChI:InChI=1/C6H9IN2O/c1-2-10-5-9-4-3-8-6(9)7/h3-4H,2,5H2,1H3
InChI key:YISOPKRYYGYKJQ-UHFFFAOYSA-N
SMILES:CCOCn1ccnc1I
Synonyms:
  • 1-(Ethoxymethyl)-2-iodo-1H-imidazole
Found 3 products.