CAS 14687-15-1
:Methylfucopyranoside
Description:
Methylfucopyranoside, with the CAS number 14687-15-1, is a carbohydrate derivative characterized by its fucose sugar structure, which is a hexose monosaccharide. This compound typically exists as a white to off-white crystalline solid and is soluble in water and various organic solvents, reflecting its polar nature due to the hydroxyl groups present. Methylfucopyranoside is often used in biochemical research and applications, particularly in the study of glycoproteins and cell signaling, as fucose plays a crucial role in various biological processes, including cell-cell recognition and immune responses. The methylation of the fucose unit enhances its stability and alters its reactivity, making it a valuable tool in synthetic chemistry and glycoscience. Additionally, it may exhibit specific biological activities, although the extent and nature of these activities can vary based on the context of its use. Overall, methylfucopyranoside serves as an important compound in both research and potential therapeutic applications.
Formula:C7H14O5
InChI:InChI=1/C7H14O5/c1-3-4(8)5(9)6(10)7(11-2)12-3/h3-10H,1-2H3/t3-,4+,5+,6-,7+/m0/s1
Synonyms:- Methyl-alpha-L-fucopyranoside
- Methyl 6-Deoxyhexopyranoside
- methyl 6-deoxy-alpha-L-galactopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Methyl α-L-Fucopyranoside
CAS:Formula:C7H14O5Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:178.18α-L-Galactopyranoside, methyl 6-deoxy-
CAS:Formula:C7H14O5Purity:98%Color and Shape:SolidMolecular weight:178.1831Methyl-a-L-fucopyranoside
CAS:Methyl-a-L-fucopyranosideFormula:C7H14O5Purity:≥98%Molecular weight:178.184Methyl α-L-fucopyranoside
CAS:(2R,3S,4R,5S,6S)-2-Methoxy-6-methyltetrahydro-2H-pyran-3,4,5-triolFormula:C7H14O5Purity:98%Molecular weight:178.18Methyl-a-L-fucopyranoside
CAS:Methyl alpha-L-fucopyranoside inhibits rhizobial lectins & Trichoderma reesei coiling; blocks PLL3, LECB, BAMBL.Formula:C7H14O5Purity:99.55%Color and Shape:SolidMolecular weight:178.18Methyl a-L-fucopyranoside
CAS:Methyl a-L-fucopyranoside is a natural product that has been shown to have many biological effects, including antioxidant and anti-inflammatory properties. It has been shown to inhibit the growth of bacteria by binding to the ribosome, preventing protein synthesis and cell division. The compound has also been shown to have anti-inflammatory effects in mice with inflammatory bowel disease. Methyl a-L-fucopyranoside inhibits the production of pro-inflammatory cytokines, such as interferon alfa-2b (IFNα2β), which is induced by IFNγ. This inhibition of IFNα2β activity may be due to methyl a-L-fucopyranoside's ability to bind to cytosolic calcium and inhibit its transport into the nucleus. Methyl a-L-fucopyranoside also blocks the production of antimicrobial peptides, such as defensins or cathelicidins.Formula:C7H14O5Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:178.18 g/mol







