CymitQuimica logo

CAS 146954-74-7

:

5'-O-(4,4'-DIMETHOXYTRITYL)-2'-FLUORO-D-URIDINE

Description:
5'-O-(4,4'-Dimethoxytrityl)-2'-fluoro-D-uridine is a modified nucleoside that features a fluorine atom at the 2' position of the ribose sugar, which enhances its stability and resistance to nucleases. This compound is characterized by the presence of a dimethoxytrityl (DMT) protecting group at the 5' position, which is commonly used in the synthesis of oligonucleotides to prevent premature reactions during the synthesis process. The fluorine substitution at the 2' position contributes to its unique biochemical properties, making it useful in various applications, including antiviral drug development and molecular biology research. The compound is typically white to off-white in appearance and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and methanol. Its molecular structure allows for specific interactions with enzymes and other biomolecules, making it a valuable tool in the study of RNA and DNA processes. As with many nucleoside analogs, it is essential to handle this compound with care, following appropriate safety protocols in a laboratory setting.
Formula:C30H29FN2O7
InChI:InChI=1S/C30H29FN2O7/c1-37-22-12-8-20(9-13-22)30(19-6-4-3-5-7-19,21-10-14-23(38-2)15-11-21)39-18-24-27(35)26(31)28(40-24)33-17-16-25(34)32-29(33)36/h3-17,24,26-28,35H,18H2,1-2H3,(H,32,34,36)/t24-,26-,27-,28-/m1/s1
InChI key:CSSFZSSZXOCCJB-YULOIDQLSA-N
SMILES:COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OC[C@@H]4[C@H]([C@H]([C@@H](O4)N5C=CC(=O)NC5=O)F)O
Synonyms:
  • 2'-Deoxy-5'-O-DMT-2'-fluoro-D-uridine
  • 2'-Deoxy-5'-O-DMT-2'-fluoro-uridine
  • 5'-O-DMT-2'-Fluoro-2'-deoxyuridine
Found 8 products.